C25H37NO4 — CID 154131742
[(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-(methoxymethoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 154131742) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is [(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-(methoxymethoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-(methoxymethoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 154131742 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | [(2S,3S,5S,8R,9S,10S,13S,14S)-17-(cyanomethylidene)-3-(methoxymethoxy)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | COCO[C@H]1C[C@@H]2CC[C@@H]3[C@H](CC[C@]4(C)C(=CC#N)CC[C@@H]34)[C@@]2(C)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H37NO4/c1-16(27)30-23-14-25(3)18(13-22(23)29-15-28-4)5-7-19-20-8-6-17(10-12-26)24(20,2)11-9-21(19)25/h10,18-23H,5-9,11,13-15H2,1-4H3/t18-,19-,20-,21-,22-,23-,24+,25-/m0/s1 |
| InChIKey | FXQCGSHPCXJZLW-DLWIPRQCSA-N |
| XLogP | 5.01 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|