C32H55NO3 — CID 18606973
(1S)-1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[6-(oxan-2-yloxy)hexoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanamine (PubChem CID 18606973) has the molecular formula C32H55NO3 and a molecular weight of 501.80 g/mol. Its IUPAC name is (1S)-1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[6-(oxan-2-yloxy)hexoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanamine.
| Compound Name | (1S)-1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[6-(oxan-2-yloxy)hexoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanamine |
|---|---|
| PubChem CID | 18606973 |
| Molecular Formula | C32H55NO3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.42 |
| IUPAC Name | (1S)-1-[(3S,10R,13S,17S)-10,13-dimethyl-3-[6-(oxan-2-yloxy)hexoxy]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanamine |
| SMILES | C[C@H](N)[C@H]1CCC2C3CC=C4C[C@@H](OCCCCCCOC5CCCCO5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H55NO3/c1-23(33)27-13-14-28-26-12-11-24-22-25(15-17-31(24,2)29(26)16-18-32(27,28)3)34-19-7-4-5-8-20-35-30-10-6-9-21-36-30/h11,23,25-30H,4-10,12-22,33H2,1-3H3/t23-,25-,26?,27+,28?,29?,30?,31-,32+/m0/s1 |
| InChIKey | HZQGQDFCKYBKFU-SZDAIRRFSA-N |
| XLogP | 7.40 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|