C26H40O3 — CID 14504366
(3S,8R,9S,10R,13S,14S,16R,17E)-17-ethylidene-10,13-dimethyl-3-(oxan-2-yloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-ol (PubChem CID 14504366) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,16R,17E)-17-ethylidene-10,13-dimethyl-3-(oxan-2-yloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,16R,17E)-17-ethylidene-10,13-dimethyl-3-(oxan-2-yloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 14504366 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,16R,17E)-17-ethylidene-10,13-dimethyl-3-(oxan-2-yloxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-ol |
| SMILES | C/C=C1/[C@H](O)C[C@H]2[C@@H]3CC=C4C[C@@H](OC5CCCCO5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40O3/c1-4-20-23(27)16-22-19-9-8-17-15-18(29-24-7-5-6-14-28-24)10-12-25(17,2)21(19)11-13-26(20,22)3/h4,8,18-19,21-24,27H,5-7,9-16H2,1-3H3/b20-4-/t18-,19+,21-,22-,23+,24?,25-,26+/m0/s1 |
| InChIKey | KSRNFXCFSKHXBY-YFDIGYFJSA-N |
| XLogP | 5.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|