C22H29NO4 — CID 58791086
(13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-carboxamide (PubChem CID 58791086) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-carboxamide.
| Compound Name | (13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-carboxamide |
|---|---|
| PubChem CID | 58791086 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (13'S)-2'-methoxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-carboxamide |
| SMILES | COc1cc2c(cc1C(N)=O)CCC1C2CC[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C22H29NO4/c1-21-7-5-14-15(18(21)6-8-22(21)26-9-10-27-22)4-3-13-11-17(20(23)24)19(25-2)12-16(13)14/h11-12,14-15,18H,3-10H2,1-2H3,(H2,23,24)/t14?,15?,18?,21-/m0/s1 |
| InChIKey | JTWQQGVDCPLULI-SVTUAZEKSA-N |
| XLogP | 3.39 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |