C28H32O2 — CID 90085953
(8'R,9'S,13'S,14'S)-13'-methyl-3'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] (PubChem CID 90085953) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is (8'R,9'S,13'S,14'S)-13'-methyl-3'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene].
| Compound Name | (8'R,9'S,13'S,14'S)-13'-methyl-3'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 90085953 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (8'R,9'S,13'S,14'S)-13'-methyl-3'-[(E)-2-phenylethenyl]spiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] |
| SMILES | C[C@]12CC[C@@H]3c4ccc(/C=C/c5ccccc5)cc4CC[C@H]3[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C28H32O2/c1-27-15-13-24-23-11-9-21(8-7-20-5-3-2-4-6-20)19-22(23)10-12-25(24)26(27)14-16-28(27)29-17-18-30-28/h2-9,11,19,24-26H,10,12-18H2,1H3/b8-7+/t24-,25-,26+,27+/m1/s1 |
| InChIKey | GNBHDQOLQUBYLV-VEBFLZCJSA-N |
| XLogP | 6.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|