C22H28O2 — CID 88991294
(13'S)-3'-ethenyl-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] (PubChem CID 88991294) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (13'S)-3'-ethenyl-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene].
| Compound Name | (13'S)-3'-ethenyl-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 88991294 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (13'S)-3'-ethenyl-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene] |
| SMILES | C=Cc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C22H28O2/c1-3-15-4-6-17-16(14-15)5-7-19-18(17)8-10-21(2)20(19)9-11-22(21)23-12-13-24-22/h3-4,6,14,18-20H,1,5,7-13H2,2H3/t18?,19?,20?,21-/m0/s1 |
| InChIKey | VKKMGQWJPCPFPA-FNNAPWSISA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |