C23H34O3Si — CID 134840225
(8'R,9'S,13'S,14'S)-13'-methyl-2'-trimethylsilylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol (PubChem CID 134840225) has the molecular formula C23H34O3Si and a molecular weight of 386.61 g/mol. Its IUPAC name is (8'R,9'S,13'S,14'S)-13'-methyl-2'-trimethylsilylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol.
| Compound Name | (8'R,9'S,13'S,14'S)-13'-methyl-2'-trimethylsilylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol |
|---|---|
| PubChem CID | 134840225 |
| Molecular Formula | C23H34O3Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (8'R,9'S,13'S,14'S)-13'-methyl-2'-trimethylsilylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol |
| SMILES | C[C@]12CC[C@@H]3c4cc([Si](C)(C)C)c(O)cc4CC[C@H]3[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C23H34O3Si/c1-22-9-7-16-17(19(22)8-10-23(22)25-11-12-26-23)6-5-15-13-20(24)21(14-18(15)16)27(2,3)4/h13-14,16-17,19,24H,5-12H2,1-4H3/t16-,17+,19-,22-/m0/s1 |
| InChIKey | VHXHXNWHGAWYES-YZIUBNRHSA-N |
| XLogP | 4.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|