C29H39NO4S — CID 21034065
3-aminoperoxysulfanyloxy-17-[(4-tert-butylphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 21034065) has the molecular formula C29H39NO4S and a molecular weight of 497.70 g/mol. Its IUPAC name is 3-aminoperoxysulfanyloxy-17-[(4-tert-butylphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 3-aminoperoxysulfanyloxy-17-[(4-tert-butylphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 21034065 |
| Molecular Formula | C29H39NO4S |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 3-aminoperoxysulfanyloxy-17-[(4-tert-butylphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC(C)(C)c1ccc(CC2(O)CCC3C4CCc5cc(OSOON)ccc5C4CCC32C)cc1 |
| InChI | InChI=1S/C29H39NO4S/c1-27(2,3)21-8-5-19(6-9-21)18-29(31)16-14-26-25-11-7-20-17-22(32-35-34-33-30)10-12-23(20)24(25)13-15-28(26,29)4/h5-6,8-10,12,17,24-26,31H,7,11,13-16,18,30H2,1-4H3 |
| InChIKey | YLFGHVFWNFROOM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|