C22H32O2 — CID 70474911
[(8S,9S,13S,14S,17R)-17-ethyl-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanol (PubChem CID 70474911) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17R)-17-ethyl-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanol.
| Compound Name | [(8S,9S,13S,14S,17R)-17-ethyl-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanol |
|---|---|
| PubChem CID | 70474911 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | [(8S,9S,13S,14S,17R)-17-ethyl-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]methanol |
| SMILES | CC[C@@]1(CO)CC[C@H]2[C@@H]3CCc4cc(OC)ccc4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H32O2/c1-4-22(14-23)12-10-20-19-7-5-15-13-16(24-3)6-8-17(15)18(19)9-11-21(20,22)2/h6,8,13,18-20,23H,4-5,7,9-12,14H2,1-3H3/t18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | KWJISZZOEJBDMO-AANPDWTMSA-N |
| XLogP | 4.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |