C21H30N3O2+ — CID 6333483
2-(17-hydroxy-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)ethylimino-iminoazanium (PubChem CID 6333483) has the molecular formula C21H30N3O2+ and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-(17-hydroxy-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)ethylimino-iminoazanium.
| Compound Name | 2-(17-hydroxy-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)ethylimino-iminoazanium |
|---|---|
| PubChem CID | 6333483 |
| Molecular Formula | C21H30N3O2+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 2-(17-hydroxy-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl)ethylimino-iminoazanium |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2(C)C1CCC2(O)CCN=[N+]=N |
| InChI | InChI=1S/C21H30N3O2/c1-20-9-7-17-16-6-4-15(26-2)13-14(16)3-5-18(17)19(20)8-10-21(20,25)11-12-23-24-22/h4,6,13,17-19,22,25H,3,5,7-12H2,1-2H3/q+1 |
| InChIKey | BWFSUOUIYULANK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|