C28H35NO2 — CID 10251413
(8R,9S,13S,14S,17S)-17-[(2,6-dimethylphenyl)iminomethyl]-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 10251413) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-17-[(2,6-dimethylphenyl)iminomethyl]-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S,17S)-17-[(2,6-dimethylphenyl)iminomethyl]-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 10251413 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (8R,9S,13S,14S,17S)-17-[(2,6-dimethylphenyl)iminomethyl]-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)/C=N/c1c(C)cccc1C |
| InChI | InChI=1S/C28H35NO2/c1-18-6-5-7-19(2)26(18)29-17-28(30)15-13-25-24-10-8-20-16-21(31-4)9-11-22(20)23(24)12-14-27(25,28)3/h5-7,9,11,16-17,23-25,30H,8,10,12-15H2,1-4H3/b29-17+/t23-,24-,25+,27+,28-/m1/s1 |
| InChIKey | JOORJDFNAINZSD-YEUVEFLQSA-N |
| XLogP | 6.30 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|