C26H33NO4S2 — CID 71120999
[(13S,17S)-13,17-dimethyl-2-methylsulfanyl-17-phenoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 71120999) has the molecular formula C26H33NO4S2 and a molecular weight of 487.69 g/mol. Its IUPAC name is [(13S,17S)-13,17-dimethyl-2-methylsulfanyl-17-phenoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(13S,17S)-13,17-dimethyl-2-methylsulfanyl-17-phenoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 71120999 |
| Molecular Formula | C26H33NO4S2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [(13S,17S)-13,17-dimethyl-2-methylsulfanyl-17-phenoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CSc1cc2c(cc1OS(N)(=O)=O)CCC1C2CC[C@@]2(C)C1CC[C@]2(C)Oc1ccccc1 |
| InChI | InChI=1S/C26H33NO4S2/c1-25-13-11-19-20(22(25)12-14-26(25,2)30-18-7-5-4-6-8-18)10-9-17-15-23(31-33(27,28)29)24(32-3)16-21(17)19/h4-8,15-16,19-20,22H,9-14H2,1-3H3,(H2,27,28,29)/t19?,20?,22?,25-,26-/m0/s1 |
| InChIKey | CFNWQUPIMFZGIO-LMBCZQAKSA-N |
| XLogP | 5.68 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |