C29H38O2S — CID 59676565
(17R)-17-[(4-tert-butylphenyl)methyl]-2-methylsulfanyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 59676565) has the molecular formula C29H38O2S and a molecular weight of 450.69 g/mol. Its IUPAC name is (17R)-17-[(4-tert-butylphenyl)methyl]-2-methylsulfanyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (17R)-17-[(4-tert-butylphenyl)methyl]-2-methylsulfanyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 59676565 |
| Molecular Formula | C29H38O2S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (17R)-17-[(4-tert-butylphenyl)methyl]-2-methylsulfanyl-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CSc1cc2c(cc1O)CCC1C2CCC2C1CC[C@@]2(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H38O2S/c1-28(2,3)20-8-5-18(6-9-20)17-29(31)14-13-23-21-10-7-19-15-26(30)27(32-4)16-24(19)22(21)11-12-25(23)29/h5-6,8-9,15-16,21-23,25,30-31H,7,10-14,17H2,1-4H3/t21?,22?,23?,25?,29-/m1/s1 |
| InChIKey | JCWZKINICKJCRC-KBKMUVRSSA-N |
| XLogP | 6.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |