C27H31N3O6 — CID 91610748
(8R,9S,13S,14S)-2-methoxy-17-(methoxyamino)-13-methyl-6-[(4-nitrophenyl)methoxyamino]-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 91610748) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-methoxy-17-(methoxyamino)-13-methyl-6-[(4-nitrophenyl)methoxyamino]-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,13S,14S)-2-methoxy-17-(methoxyamino)-13-methyl-6-[(4-nitrophenyl)methoxyamino]-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 91610748 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (8R,9S,13S,14S)-2-methoxy-17-(methoxyamino)-13-methyl-6-[(4-nitrophenyl)methoxyamino]-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CONC1=CC[C@H]2[C@@H]3C=C(NOCc4ccc([N+](=O)[O-])cc4)c4cc(O)c(OC)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H31N3O6/c1-27-11-10-18-19-14-25(34-2)24(31)13-21(19)23(12-20(18)22(27)8-9-26(27)29-35-3)28-36-15-16-4-6-17(7-5-16)30(32)33/h4-7,9,12-14,18,20,22,28-29,31H,8,10-11,15H2,1-3H3/t18-,20-,22+,27+/m1/s1 |
| InChIKey | OYKYCFRRRLIBGQ-OWFMSYNYSA-N |
| XLogP | 4.94 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|