C24H28N2O4 — CID 91383695
(8R,9S,13S,14S,17S)-2-methoxy-13-methyl-6-(pyridin-2-yloxyamino)-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 91383695) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-2-methoxy-13-methyl-6-(pyridin-2-yloxyamino)-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-2-methoxy-13-methyl-6-(pyridin-2-yloxyamino)-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 91383695 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (8R,9S,13S,14S,17S)-2-methoxy-13-methyl-6-(pyridin-2-yloxyamino)-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | COc1cc2c(cc1O)C(NOc1ccccn1)=C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C24H28N2O4/c1-24-9-8-14-15-13-21(29-2)20(27)12-17(15)19(26-30-23-5-3-4-10-25-23)11-16(14)18(24)6-7-22(24)28/h3-5,10-14,16,18,22,26-28H,6-9H2,1-2H3/t14-,16-,18+,22+,24+/m1/s1 |
| InChIKey | QOMWQDSXZRMGCD-XJYQPQAZSA-N |
| XLogP | 4.00 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|