C19H24O4 — CID 54289334
(13S)-3,17-dihydroxy-2-methoxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 54289334) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (13S)-3,17-dihydroxy-2-methoxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (13S)-3,17-dihydroxy-2-methoxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 54289334 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (13S)-3,17-dihydroxy-2-methoxy-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | COc1cc2c(cc1O)C(=O)CC1C2CC[C@]2(C)C(O)CCC12 |
| InChI | InChI=1S/C19H24O4/c1-19-6-5-10-11-9-17(23-2)16(21)8-13(11)15(20)7-12(10)14(19)3-4-18(19)22/h8-10,12,14,18,21-22H,3-7H2,1-2H3/t10?,12?,14?,18?,19-/m0/s1 |
| InChIKey | RWJZABXDKZTYEV-CMPMFBDJSA-N |
| XLogP | 3.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |