C20H27NO4 — CID 93475837
(6Z,8S,9S,13R,14R,17S)-2-ethoxy-6-hydroxyimino-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 93475837) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (6Z,8S,9S,13R,14R,17S)-2-ethoxy-6-hydroxyimino-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (6Z,8S,9S,13R,14R,17S)-2-ethoxy-6-hydroxyimino-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 93475837 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (6Z,8S,9S,13R,14R,17S)-2-ethoxy-6-hydroxyimino-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCOc1cc2c(cc1O)/C(=N\O)C[C@H]1[C@@H]2CC[C@]2(C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C20H27NO4/c1-3-25-18-10-12-11-6-7-20(2)15(4-5-19(20)23)13(11)8-16(21-24)14(12)9-17(18)22/h9-11,13,15,19,22-24H,3-8H2,1-2H3/b21-16-/t11-,13+,15-,19+,20-/m1/s1 |
| InChIKey | SMKGGPJGMFBQDP-FVIZNDIWSA-N |
| XLogP | 3.64 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|