C21H29NO4 — CID 10832320
(9Z,15S,16S)-4-ethoxy-9-hydroxyimino-16-methyltetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-triene-5,15-diol (PubChem CID 10832320) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (9Z,15S,16S)-4-ethoxy-9-hydroxyimino-16-methyltetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-triene-5,15-diol.
| Compound Name | (9Z,15S,16S)-4-ethoxy-9-hydroxyimino-16-methyltetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-triene-5,15-diol |
|---|---|
| PubChem CID | 10832320 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (9Z,15S,16S)-4-ethoxy-9-hydroxyimino-16-methyltetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-triene-5,15-diol |
| SMILES | CCOc1cc2c(cc1O)C/C(=N\O)CC1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C21H29NO4/c1-3-26-19-11-15-12(9-18(19)23)8-13(22-25)10-16-14(15)6-7-21(2)17(16)4-5-20(21)24/h9,11,14,16-17,20,23-25H,3-8,10H2,1-2H3/b22-13+/t14?,16?,17?,20-,21-/m0/s1 |
| InChIKey | XSKVNHVTCBKDBD-TZZADKLZSA-N |
| XLogP | 3.84 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|