C27H33NO5 — CID 90813022
(8R,9S,13S,14S,17S)-2-methoxy-6-[(4-methoxyphenyl)methoxyamino]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 90813022) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-2-methoxy-6-[(4-methoxyphenyl)methoxyamino]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-2-methoxy-6-[(4-methoxyphenyl)methoxyamino]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 90813022 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (8R,9S,13S,14S,17S)-2-methoxy-6-[(4-methoxyphenyl)methoxyamino]-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | COc1ccc(CONC2=C[C@@H]3[C@H](CC[C@]4(C)[C@@H](O)CC[C@@H]34)c3cc(OC)c(O)cc32)cc1 |
| InChI | InChI=1S/C27H33NO5/c1-27-11-10-18-19-14-25(32-3)24(29)13-21(19)23(12-20(18)22(27)8-9-26(27)30)28-33-15-16-4-6-17(31-2)7-5-16/h4-7,12-14,18,20,22,26,28-30H,8-11,15H2,1-3H3/t18-,20-,22+,26+,27+/m1/s1 |
| InChIKey | HFZUVZKAKPUMMF-NHIMCBKFSA-N |
| XLogP | 4.76 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|