C26H29N3O6 — CID 59013604
(6E,8R,9S,13S,14S,17E)-17-hydroxyimino-2-methoxy-13-methyl-6-[(3-nitrophenyl)methoxyimino]-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 59013604) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is (6E,8R,9S,13S,14S,17E)-17-hydroxyimino-2-methoxy-13-methyl-6-[(3-nitrophenyl)methoxyimino]-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (6E,8R,9S,13S,14S,17E)-17-hydroxyimino-2-methoxy-13-methyl-6-[(3-nitrophenyl)methoxyimino]-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59013604 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (6E,8R,9S,13S,14S,17E)-17-hydroxyimino-2-methoxy-13-methyl-6-[(3-nitrophenyl)methoxyimino]-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | COc1cc2c(cc1O)/C(=N/OCc1cccc([N+](=O)[O-])c1)C[C@@H]1[C@@H]2CC[C@]2(C)/C(=N/O)CC[C@@H]12 |
| InChI | InChI=1S/C26H29N3O6/c1-26-9-8-17-18-13-24(34-2)23(30)12-20(18)22(11-19(17)21(26)6-7-25(26)27-31)28-35-14-15-4-3-5-16(10-15)29(32)33/h3-5,10,12-13,17,19,21,30-31H,6-9,11,14H2,1-2H3/b27-25+,28-22+/t17-,19-,21+,26+/m1/s1 |
| InChIKey | QDAXFPUDUFFQRE-DAXKBDNOSA-N |
| XLogP | 5.37 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|