C30H44O7S — CID 172866354
[(7S,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-7-(9-methylsulfonyloxynonyl)-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 172866354) has the molecular formula C30H44O7S and a molecular weight of 548.74 g/mol. Its IUPAC name is [(7S,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-7-(9-methylsulfonyloxynonyl)-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7S,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-7-(9-methylsulfonyloxynonyl)-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 172866354 |
| Molecular Formula | C30H44O7S |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | [(7S,8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-7-(9-methylsulfonyloxynonyl)-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3[C@H](CCCCCCCCCOS(C)(=O)=O)C(=O)c4cc(O)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H44O7S/c1-20(31)37-27-15-14-26-28-23(16-17-30(26,27)2)22-13-12-21(32)19-25(22)29(33)24(28)11-9-7-5-4-6-8-10-18-36-38(3,34)35/h12-13,19,23-24,26-28,32H,4-11,14-18H2,1-3H3/t23-,24+,26+,27+,28+,30+/m1/s1 |
| InChIKey | PPNZSZPRKBUZJE-GYKPOOFLSA-N |
| XLogP | 6.14 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|