C11H9BrO3 — CID 90807164
2-bromo-3-(2,5-dihydroxyphenyl)cyclopent-2-en-1-one (PubChem CID 90807164) has the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. Its IUPAC name is 2-bromo-3-(2,5-dihydroxyphenyl)cyclopent-2-en-1-one.
| Compound Name | 2-bromo-3-(2,5-dihydroxyphenyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 90807164 |
| Molecular Formula | C11H9BrO3 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-bromo-3-(2,5-dihydroxyphenyl)cyclopent-2-en-1-one |
| SMILES | O=C1CCC(c2cc(O)ccc2O)=C1Br |
| InChI | InChI=1S/C11H9BrO3/c12-11-7(2-4-10(11)15)8-5-6(13)1-3-9(8)14/h1,3,5,13-14H,2,4H2 |
| InChIKey | FAJXZRHKKWAGKC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|