C14H13BrO2 — CID 10108425
1-bromo-7-hydroxy-3a-methyl-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one (PubChem CID 10108425) has the molecular formula C14H13BrO2 and a molecular weight of 293.16 g/mol. Its IUPAC name is 1-bromo-7-hydroxy-3a-methyl-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one.
| Compound Name | 1-bromo-7-hydroxy-3a-methyl-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 10108425 |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-bromo-7-hydroxy-3a-methyl-4,5-dihydro-3H-cyclopenta[a]naphthalen-2-one |
| SMILES | CC12CCc3cc(O)ccc3C1=C(Br)C(=O)C2 |
| InChI | InChI=1S/C14H13BrO2/c1-14-5-4-8-6-9(16)2-3-10(8)12(14)13(15)11(17)7-14/h2-3,6,16H,4-5,7H2,1H3 |
| InChIKey | ULWVLFJGDHUIMS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|