About 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol
2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol (PubChem CID 71015748) has the molecular formula C18H14O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol |
| PubChem CID | 71015748 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2ccc(-c3cc(O)ccc3O)cc2)c1 |
| InChI | InChI=1S/C18H14O4/c19-13-5-7-17(21)15(9-13)11-1-2-12(4-3-11)16-10-14(20)6-8-18(16)22/h1-10,19-22H |
| InChIKey | GRNMPBPVIGOIRO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
The IUPAC name of 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol (CID 71015748) is 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol.
What is the SMILES notation for 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
The canonical SMILES for 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol is Oc1ccc(O)c(-c2ccc(-c3cc(O)ccc3O)cc2)c1.
What is the InChIKey of 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
The InChIKey is GRNMPBPVIGOIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4/c19-13-5-7-17(21)15(9-13)11-1-2-12(4-3-11)16-10-14(20)6-8-18(16)22/h1-10,19-22H.
What are the key properties of 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol has a molecular weight of 294.31 g/mol, XLogP of 3.84, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol is sourced from PubChem (CID 71015748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).