C18H18O8 — CID 102220230
2-[(1S,10R,11R,13R,14R)-7,14-dihydroxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl]acetic acid (PubChem CID 102220230) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-[(1S,10R,11R,13R,14R)-7,14-dihydroxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl]acetic acid.
| Compound Name | 2-[(1S,10R,11R,13R,14R)-7,14-dihydroxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl]acetic acid |
|---|---|
| PubChem CID | 102220230 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-[(1S,10R,11R,13R,14R)-7,14-dihydroxy-2,9-dioxo-11-propyl-12,15-dioxatetracyclo[8.4.1.01,10.03,8]pentadeca-3(8),4,6-trien-13-yl]acetic acid |
| SMILES | CCC[C@H]1O[C@H](CC(=O)O)[C@@H](O)[C@]23O[C@]12C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C18H18O8/c1-2-4-11-17-16(24)13-8(5-3-6-9(13)19)14(22)18(17,26-17)15(23)10(25-11)7-12(20)21/h3,5-6,10-11,15,19,23H,2,4,7H2,1H3,(H,20,21)/t10-,11-,15-,17+,18+/m1/s1 |
| InChIKey | MZDTVMJQBVIEHD-PBYUSECUSA-N |
| XLogP | 0.68 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|