C26H20O8 — CID 177473162
2-[(1R,13S,14S,23S,25S)-9,20-dihydroxy-23-methyl-15,22-dioxo-12,24-dioxahexacyclo[11.9.3.01,14.02,11.05,10.016,21]pentacosa-2(11),3,5(10),6,8,16(21),17,19-octaen-25-yl]acetic acid (PubChem CID 177473162) has the molecular formula C26H20O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is 2-[(1R,13S,14S,23S,25S)-9,20-dihydroxy-23-methyl-15,22-dioxo-12,24-dioxahexacyclo[11.9.3.01,14.02,11.05,10.016,21]pentacosa-2(11),3,5(10),6,8,16(21),17,19-octaen-25-yl]acetic acid.
| Compound Name | 2-[(1R,13S,14S,23S,25S)-9,20-dihydroxy-23-methyl-15,22-dioxo-12,24-dioxahexacyclo[11.9.3.01,14.02,11.05,10.016,21]pentacosa-2(11),3,5(10),6,8,16(21),17,19-octaen-25-yl]acetic acid |
|---|---|
| PubChem CID | 177473162 |
| Molecular Formula | C26H20O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-[(1R,13S,14S,23S,25S)-9,20-dihydroxy-23-methyl-15,22-dioxo-12,24-dioxahexacyclo[11.9.3.01,14.02,11.05,10.016,21]pentacosa-2(11),3,5(10),6,8,16(21),17,19-octaen-25-yl]acetic acid |
| SMILES | C[C@@H]1O[C@@H](CC(=O)O)[C@H]2Oc3c(ccc4cccc(O)c34)[C@@]13C(=O)c1c(O)cccc1C(=O)[C@H]23 |
| InChI | InChI=1S/C26H20O8/c1-11-26-14-9-8-12-4-2-6-15(27)19(12)23(14)34-24(17(33-11)10-18(29)30)21(26)22(31)13-5-3-7-16(28)20(13)25(26)32/h2-9,11,17,21,24,27-28H,10H2,1H3,(H,29,30)/t11-,17-,21+,24+,26-/m0/s1 |
| InChIKey | XUMOMPKFESASJD-YPARPMQYSA-N |
| XLogP | 3.21 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|