C13H10O7 — CID 177453686
(1R,10R,13R)-4,13-dihydroxy-6-methoxy-12,14-dioxatetracyclo[8.3.1.01,10.03,8]tetradeca-3(8),4,6-triene-2,9-dione (PubChem CID 177453686) has the molecular formula C13H10O7 and a molecular weight of 278.22 g/mol. Its IUPAC name is (1R,10R,13R)-4,13-dihydroxy-6-methoxy-12,14-dioxatetracyclo[8.3.1.01,10.03,8]tetradeca-3(8),4,6-triene-2,9-dione.
| Compound Name | (1R,10R,13R)-4,13-dihydroxy-6-methoxy-12,14-dioxatetracyclo[8.3.1.01,10.03,8]tetradeca-3(8),4,6-triene-2,9-dione |
|---|---|
| PubChem CID | 177453686 |
| Molecular Formula | C13H10O7 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (1R,10R,13R)-4,13-dihydroxy-6-methoxy-12,14-dioxatetracyclo[8.3.1.01,10.03,8]tetradeca-3(8),4,6-triene-2,9-dione |
| SMILES | COc1cc(O)c2c(c1)C(=O)[C@@]13CO[C@@H](O)[C@@]1(O3)C2=O |
| InChI | InChI=1S/C13H10O7/c1-18-5-2-6-8(7(14)3-5)10(16)13-11(17)19-4-12(13,20-13)9(6)15/h2-3,11,14,17H,4H2,1H3/t11-,12+,13+/m1/s1 |
| InChIKey | ZCLXGOCMYIAPIN-AGIUHOORSA-N |
| XLogP | -0.36 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|