C11H13NO3 — CID 121345070
2-(5-methoxy-2,3-dihydro-1-benzofuran-2-yl)acetamide (PubChem CID 121345070) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(5-methoxy-2,3-dihydro-1-benzofuran-2-yl)acetamide.
| Compound Name | 2-(5-methoxy-2,3-dihydro-1-benzofuran-2-yl)acetamide |
|---|---|
| PubChem CID | 121345070 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(5-methoxy-2,3-dihydro-1-benzofuran-2-yl)acetamide |
| SMILES | COc1ccc2c(c1)CC(CC(N)=O)O2 |
| InChI | InChI=1S/C11H13NO3/c1-14-8-2-3-10-7(4-8)5-9(15-10)6-11(12)13/h2-4,9H,5-6H2,1H3,(H2,12,13) |
| InChIKey | DEJRTECZWODITP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |