C17H12F5NO3 — CID 92760110
2,3,4,5,6-pentafluoro-N-[[(2S)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide (PubChem CID 92760110) has the molecular formula C17H12F5NO3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[(2S)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[(2S)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 92760110 |
| Molecular Formula | C17H12F5NO3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[(2S)-5-methoxy-2,3-dihydro-1-benzofuran-2-yl]methyl]benzamide |
| SMILES | COc1ccc2c(c1)C[C@@H](CNC(=O)c1c(F)c(F)c(F)c(F)c1F)O2 |
| InChI | InChI=1S/C17H12F5NO3/c1-25-8-2-3-10-7(4-8)5-9(26-10)6-23-17(24)11-12(18)14(20)16(22)15(21)13(11)19/h2-4,9H,5-6H2,1H3,(H,23,24)/t9-/m0/s1 |
| InChIKey | DXZVVWIMXVKMQN-VIFPVBQESA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|