C10H10FNO2 — CID 121345057
2-(6-fluoro-2,3-dihydro-1-benzofuran-2-yl)acetamide (PubChem CID 121345057) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydro-1-benzofuran-2-yl)acetamide.
| Compound Name | 2-(6-fluoro-2,3-dihydro-1-benzofuran-2-yl)acetamide |
|---|---|
| PubChem CID | 121345057 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydro-1-benzofuran-2-yl)acetamide |
| SMILES | NC(=O)CC1Cc2ccc(F)cc2O1 |
| InChI | InChI=1S/C10H10FNO2/c11-7-2-1-6-3-8(5-10(12)13)14-9(6)4-7/h1-2,4,8H,3,5H2,(H2,12,13) |
| InChIKey | PAUFQGJYBFIFRI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |