C10H11FO — CID 126553111
2-ethyl-6-fluoro-2,3-dihydro-1-benzofuran (PubChem CID 126553111) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-2,3-dihydro-1-benzofuran.
| Compound Name | 2-ethyl-6-fluoro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 126553111 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2-ethyl-6-fluoro-2,3-dihydro-1-benzofuran |
| SMILES | CCC1Cc2ccc(F)cc2O1 |
| InChI | InChI=1S/C10H11FO/c1-2-9-5-7-3-4-8(11)6-10(7)12-9/h3-4,6,9H,2,5H2,1H3 |
| InChIKey | UKAQKNDNIKSQKV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |