C11H13FO2 — CID 104948099
(4S)-2-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104948099) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is (4S)-2-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104948099 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (4S)-2-ethyl-6-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCC1C[C@H](O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C11H13FO2/c1-2-8-6-10(13)9-5-7(12)3-4-11(9)14-8/h3-5,8,10,13H,2,6H2,1H3/t8?,10-/m0/s1 |
| InChIKey | AXDKNYQCYXQWEU-HTLJXXAVSA-N |
| XLogP | 2.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |