C18H22O7 — CID 142337135
benzene-1,2-diol;ethane;4,6,8-trihydroxy-3,4-dihydro-2H-1-benzoxepin-5-one (PubChem CID 142337135) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is benzene-1,2-diol;ethane;4,6,8-trihydroxy-3,4-dihydro-2H-1-benzoxepin-5-one.
| Compound Name | benzene-1,2-diol;ethane;4,6,8-trihydroxy-3,4-dihydro-2H-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 142337135 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | benzene-1,2-diol;ethane;4,6,8-trihydroxy-3,4-dihydro-2H-1-benzoxepin-5-one |
| SMILES | CC.O=C1c2c(O)cc(O)cc2OCCC1O.Oc1ccccc1O |
| InChI | InChI=1S/C10H10O5.C6H6O2.C2H6/c11-5-3-7(13)9-8(4-5)15-2-1-6(12)10(9)14;7-5-3-1-2-4-6(5)8;1-2/h3-4,6,11-13H,1-2H2;1-4,7-8H;1-2H3 |
| InChIKey | ODIPQOAINCKVON-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|