C30H22O14 — CID 175835485
(2R,3R)-2-(3,4-dihydroxyphenyl)-2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-3H-chromen-2-yl]-3,5,7-trihydroxy-3H-chromen-4-one (PubChem CID 175835485) has the molecular formula C30H22O14 and a molecular weight of 606.49 g/mol. Its IUPAC name is (2R,3R)-2-(3,4-dihydroxyphenyl)-2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-3H-chromen-2-yl]-3,5,7-trihydroxy-3H-chromen-4-one.
| Compound Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-3H-chromen-2-yl]-3,5,7-trihydroxy-3H-chromen-4-one |
|---|---|
| PubChem CID | 175835485 |
| Molecular Formula | C30H22O14 |
| Molecular Weight | 606.49 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-3H-chromen-2-yl]-3,5,7-trihydroxy-3H-chromen-4-one |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@@](c2ccc(O)c(O)c2)([C@]2(c3ccc(O)c(O)c3)Oc3cc(O)cc(O)c3C(=O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C30H22O14/c31-13-7-19(37)23-21(9-13)43-29(27(41)25(23)39,11-1-3-15(33)17(35)5-11)30(12-2-4-16(34)18(36)6-12)28(42)26(40)24-20(38)8-14(32)10-22(24)44-30/h1-10,27-28,31-38,41-42H/t27-,28-,29+,30+/m0/s1 |
| InChIKey | BDPQTPCTRGIVGG-VZNYXHRGSA-N |
| XLogP | 1.69 |
| TPSA | 254.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|