C15H11Br3O6 — CID 139898380
(3R)-2,3,4-tribromo-2-(3,4-dihydroxyphenyl)-4H-chromene-3,5,7-triol (PubChem CID 139898380) has the molecular formula C15H11Br3O6 and a molecular weight of 526.96 g/mol. Its IUPAC name is (3R)-2,3,4-tribromo-2-(3,4-dihydroxyphenyl)-4H-chromene-3,5,7-triol.
| Compound Name | (3R)-2,3,4-tribromo-2-(3,4-dihydroxyphenyl)-4H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 139898380 |
| Molecular Formula | C15H11Br3O6 |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 523.81 |
| IUPAC Name | (3R)-2,3,4-tribromo-2-(3,4-dihydroxyphenyl)-4H-chromene-3,5,7-triol |
| SMILES | Oc1cc(O)c2c(c1)OC(Br)(c1ccc(O)c(O)c1)[C@](O)(Br)C2Br |
| InChI | InChI=1S/C15H11Br3O6/c16-13-12-10(22)4-7(19)5-11(12)24-15(18,14(13,17)23)6-1-2-8(20)9(21)3-6/h1-5,13,19-23H/t13?,14-,15?/m0/s1 |
| InChIKey | HYKPELRAKDYKLZ-SLTAFYQDSA-N |
| XLogP | 3.67 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|