C30H26O12 — CID 102453656
(1R,9S)-9-(3,4-dihydroxyphenyl)-4-[(2S)-3-(3,4-dihydroxyphenyl)-2-hydroxypropyl]-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11,13,15-hexaene-3,5,13,15,17-pentol (PubChem CID 102453656) has the molecular formula C30H26O12 and a molecular weight of 578.53 g/mol. Its IUPAC name is (1R,9S)-9-(3,4-dihydroxyphenyl)-4-[(2S)-3-(3,4-dihydroxyphenyl)-2-hydroxypropyl]-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11,13,15-hexaene-3,5,13,15,17-pentol.
| Compound Name | (1R,9S)-9-(3,4-dihydroxyphenyl)-4-[(2S)-3-(3,4-dihydroxyphenyl)-2-hydroxypropyl]-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11,13,15-hexaene-3,5,13,15,17-pentol |
|---|---|
| PubChem CID | 102453656 |
| Molecular Formula | C30H26O12 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (1R,9S)-9-(3,4-dihydroxyphenyl)-4-[(2S)-3-(3,4-dihydroxyphenyl)-2-hydroxypropyl]-8,10-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),3,5,11,13,15-hexaene-3,5,13,15,17-pentol |
| SMILES | Oc1cc(O)c2c(c1)O[C@@]1(c3ccc(O)c(O)c3)Oc3cc(O)c(C[C@@H](O)Cc4ccc(O)c(O)c4)c(O)c3[C@@H]2C1O |
| InChI | InChI=1S/C30H26O12/c31-14(5-12-1-3-17(33)20(36)6-12)8-16-19(35)11-24-26(28(16)39)27-25-22(38)9-15(32)10-23(25)41-30(42-24,29(27)40)13-2-4-18(34)21(37)7-13/h1-4,6-7,9-11,14,27,29,31-40H,5,8H2/t14-,27+,29?,30-/m0/s1 |
| InChIKey | ZGESHOZJVPORTE-UXQMCQQASA-N |
| XLogP | 2.61 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|