C30H24O11 — CID 101483204
(1S,6R,7R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-8,12,14-trioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),3,9,15,17,19-hexaene-6,17,19,21-tetrol (PubChem CID 101483204) has the molecular formula C30H24O11 and a molecular weight of 560.51 g/mol. Its IUPAC name is (1S,6R,7R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-8,12,14-trioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),3,9,15,17,19-hexaene-6,17,19,21-tetrol.
| Compound Name | (1S,6R,7R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-8,12,14-trioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),3,9,15,17,19-hexaene-6,17,19,21-tetrol |
|---|---|
| PubChem CID | 101483204 |
| Molecular Formula | C30H24O11 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | (1S,6R,7R,13R,21R)-7,13-bis(3,4-dihydroxyphenyl)-8,12,14-trioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),3,9,15,17,19-hexaene-6,17,19,21-tetrol |
| SMILES | Oc1cc(O)c2c(c1)O[C@@]1(c3ccc(O)c(O)c3)Oc3cc4c(cc3[C@@H]2[C@H]1O)C[C@@H](O)[C@@H](c1ccc(O)c(O)c1)O4 |
| InChI | InChI=1S/C30H24O11/c31-15-9-21(36)27-25(10-15)41-30(14-2-4-18(33)20(35)8-14)29(38)26(27)16-5-13-7-22(37)28(39-23(13)11-24(16)40-30)12-1-3-17(32)19(34)6-12/h1-6,8-11,22,26,28-29,31-38H,7H2/t22-,26+,28-,29-,30-/m1/s1 |
| InChIKey | RKMNXPJHDRZJRD-LGYLCNMQSA-N |
| XLogP | 3.09 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|