C15H12O7 — CID 91270469
(2R)-2,4,5,7-tetrahydroxy-2-(4-hydroxyphenyl)-4H-chromen-3-one (PubChem CID 91270469) has the molecular formula C15H12O7 and a molecular weight of 304.25 g/mol. Its IUPAC name is (2R)-2,4,5,7-tetrahydroxy-2-(4-hydroxyphenyl)-4H-chromen-3-one.
| Compound Name | (2R)-2,4,5,7-tetrahydroxy-2-(4-hydroxyphenyl)-4H-chromen-3-one |
|---|---|
| PubChem CID | 91270469 |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2R)-2,4,5,7-tetrahydroxy-2-(4-hydroxyphenyl)-4H-chromen-3-one |
| SMILES | O=C1C(O)c2c(O)cc(O)cc2O[C@]1(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H12O7/c16-8-3-1-7(2-4-8)15(21)14(20)13(19)12-10(18)5-9(17)6-11(12)22-15/h1-6,13,16-19,21H/t13?,15-/m1/s1 |
| InChIKey | UOKBKSGJXGOJMX-AWKYBWMHSA-N |
| XLogP | 0.64 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |