C16H12Cl2O5 — CID 129013800
2-(dichloromethyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3H-chromen-4-one (PubChem CID 129013800) has the molecular formula C16H12Cl2O5 and a molecular weight of 355.17 g/mol. Its IUPAC name is 2-(dichloromethyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3H-chromen-4-one.
| Compound Name | 2-(dichloromethyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 129013800 |
| Molecular Formula | C16H12Cl2O5 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 2-(dichloromethyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-3H-chromen-4-one |
| SMILES | O=C1CC(c2ccc(O)cc2)(C(Cl)Cl)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C16H12Cl2O5/c17-15(18)16(8-1-3-9(19)4-2-8)7-12(22)14-11(21)5-10(20)6-13(14)23-16/h1-6,15,19-21H,7H2 |
| InChIKey | YXTXYWHIADWVLI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|