C20H20O5 — CID 171393850
5,7-dihydroxy-2-(4-hydroxyphenyl)-2-[(E)-pent-1-enyl]-3H-chromen-4-one (PubChem CID 171393850) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-2-[(E)-pent-1-enyl]-3H-chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-2-[(E)-pent-1-enyl]-3H-chromen-4-one |
|---|---|
| PubChem CID | 171393850 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-2-[(E)-pent-1-enyl]-3H-chromen-4-one |
| SMILES | CCC/C=C/C1(c2ccc(O)cc2)CC(=O)c2c(O)cc(O)cc2O1 |
| InChI | InChI=1S/C20H20O5/c1-2-3-4-9-20(13-5-7-14(21)8-6-13)12-17(24)19-16(23)10-15(22)11-18(19)25-20/h4-11,21-23H,2-3,12H2,1H3/b9-4+ |
| InChIKey | CHXNWBKIMSDIQP-RUDMXATFSA-N |
| XLogP | 4.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|