C16H18O4 — CID 162814302
3-hepta-1,3-dienyl-6,8-dihydroxy-3,4-dihydroisochromen-1-one (PubChem CID 162814302) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-hepta-1,3-dienyl-6,8-dihydroxy-3,4-dihydroisochromen-1-one.
| Compound Name | 3-hepta-1,3-dienyl-6,8-dihydroxy-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 162814302 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-hepta-1,3-dienyl-6,8-dihydroxy-3,4-dihydroisochromen-1-one |
| SMILES | CCCC=CC=CC1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C16H18O4/c1-2-3-4-5-6-7-13-9-11-8-12(17)10-14(18)15(11)16(19)20-13/h4-8,10,13,17-18H,2-3,9H2,1H3 |
| InChIKey | NWSIBKOHHNLGBR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|