C12H10O6 — CID 170990380
(E)-3-[(3R)-6,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl]prop-2-enoic acid (PubChem CID 170990380) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is (E)-3-[(3R)-6,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(3R)-6,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170990380 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (E)-3-[(3R)-6,8-dihydroxy-1-oxo-3,4-dihydroisochromen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/[C@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C12H10O6/c13-7-3-6-4-8(1-2-10(15)16)18-12(17)11(6)9(14)5-7/h1-3,5,8,13-14H,4H2,(H,15,16)/b2-1+/t8-/m0/s1 |
| InChIKey | CONQPAAYLBYSGF-CMLYIYFCSA-N |
| XLogP | 0.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|