C20H28O5 — CID 122368158
(3R)-6,8-dihydroxy-3-(7-oxoundecyl)-3,4-dihydroisochromen-1-one (PubChem CID 122368158) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (3R)-6,8-dihydroxy-3-(7-oxoundecyl)-3,4-dihydroisochromen-1-one.
| Compound Name | (3R)-6,8-dihydroxy-3-(7-oxoundecyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 122368158 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (3R)-6,8-dihydroxy-3-(7-oxoundecyl)-3,4-dihydroisochromen-1-one |
| SMILES | CCCCC(=O)CCCCCC[C@@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H28O5/c1-2-3-8-15(21)9-6-4-5-7-10-17-12-14-11-16(22)13-18(23)19(14)20(24)25-17/h11,13,17,22-23H,2-10,12H2,1H3/t17-/m1/s1 |
| InChIKey | GPDVRRIWIBEELT-QGZVFWFLSA-N |
| XLogP | 4.28 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|