C20H18O7 — CID 101110303
1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one (PubChem CID 101110303) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one.
| Compound Name | 1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one |
|---|---|
| PubChem CID | 101110303 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1,3,8,10a-tetrahydroxy-5a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one |
| SMILES | CC(C)=CCC12Oc3cc(O)cc(O)c3C(=O)C1(O)Oc1cc(O)ccc12 |
| InChI | InChI=1S/C20H18O7/c1-10(2)5-6-19-13-4-3-11(21)8-15(13)27-20(19,25)18(24)17-14(23)7-12(22)9-16(17)26-19/h3-5,7-9,21-23,25H,6H2,1-2H3 |
| InChIKey | OGQOIJNXVULVKD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|