C15H10O8 — CID 162907894
(2S)-2-(3,4-dihydroxybenzoyl)-2,4,6-trihydroxy-1-benzofuran-3-one (PubChem CID 162907894) has the molecular formula C15H10O8 and a molecular weight of 318.24 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydroxybenzoyl)-2,4,6-trihydroxy-1-benzofuran-3-one.
| Compound Name | (2S)-2-(3,4-dihydroxybenzoyl)-2,4,6-trihydroxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 162907894 |
| Molecular Formula | C15H10O8 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (2S)-2-(3,4-dihydroxybenzoyl)-2,4,6-trihydroxy-1-benzofuran-3-one |
| SMILES | O=C(c1ccc(O)c(O)c1)[C@]1(O)Oc2cc(O)cc(O)c2C1=O |
| InChI | InChI=1S/C15H10O8/c16-7-4-10(19)12-11(5-7)23-15(22,14(12)21)13(20)6-1-2-8(17)9(18)3-6/h1-5,16-19,22H/t15-/m0/s1 |
| InChIKey | UYFQPTAFLCOYSM-HNNXBMFYSA-N |
| XLogP | 0.66 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|