C16H14O8 — CID 146681561
3,3,5,7-tetrahydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-chromen-4-one (PubChem CID 146681561) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is 3,3,5,7-tetrahydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-chromen-4-one.
| Compound Name | 3,3,5,7-tetrahydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-chromen-4-one |
|---|---|
| PubChem CID | 146681561 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3,3,5,7-tetrahydroxy-2-(4-hydroxy-3-methoxyphenyl)-2H-chromen-4-one |
| SMILES | COc1cc(C2Oc3cc(O)cc(O)c3C(=O)C2(O)O)ccc1O |
| InChI | InChI=1S/C16H14O8/c1-23-11-4-7(2-3-9(11)18)15-16(21,22)14(20)13-10(19)5-8(17)6-12(13)24-15/h2-6,15,17-19,21-22H,1H3 |
| InChIKey | FUMUNGQCTKCKBB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|