C17H14O9 — CID 175761894
2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-2H-chromen-3-yl]acetic acid (PubChem CID 175761894) has the molecular formula C17H14O9 and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-2H-chromen-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-2H-chromen-3-yl]acetic acid |
|---|---|
| PubChem CID | 175761894 |
| Molecular Formula | C17H14O9 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4-oxo-2H-chromen-3-yl]acetic acid |
| SMILES | O=C(O)C[C@]1(O)C(=O)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H14O9/c18-8-4-11(21)14-12(5-8)26-16(7-1-2-9(19)10(20)3-7)17(25,15(14)24)6-13(22)23/h1-5,16,18-21,25H,6H2,(H,22,23)/t16-,17+/m1/s1 |
| InChIKey | RWSRLMAPEAZQDN-SJORKVTESA-N |
| XLogP | 1.03 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|