C18H18O7 — CID 91061937
1-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,4-dihydrochromen-3-yl]propan-1-one (PubChem CID 91061937) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,4-dihydrochromen-3-yl]propan-1-one.
| Compound Name | 1-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,4-dihydrochromen-3-yl]propan-1-one |
|---|---|
| PubChem CID | 91061937 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,4-dihydrochromen-3-yl]propan-1-one |
| SMILES | CCC(=O)[C@]1(O)Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H18O7/c1-2-16(23)18(24)8-11-13(21)6-10(19)7-15(11)25-17(18)9-3-4-12(20)14(22)5-9/h3-7,17,19-22,24H,2,8H2,1H3/t17-,18-/m1/s1 |
| InChIKey | DLYGYSBTXDCZIP-QZTJIDSGSA-N |
| XLogP | 1.90 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|