C16H16O6 — CID 71007772
2-(4-hydroxyphenyl)-3-methoxy-2,4-dihydrochromene-3,5,7-triol (PubChem CID 71007772) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-methoxy-2,4-dihydrochromene-3,5,7-triol.
| Compound Name | 2-(4-hydroxyphenyl)-3-methoxy-2,4-dihydrochromene-3,5,7-triol |
|---|---|
| PubChem CID | 71007772 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-methoxy-2,4-dihydrochromene-3,5,7-triol |
| SMILES | COC1(O)Cc2c(O)cc(O)cc2OC1c1ccc(O)cc1 |
| InChI | InChI=1S/C16H16O6/c1-21-16(20)8-12-13(19)6-11(18)7-14(12)22-15(16)9-2-4-10(17)5-3-9/h2-7,15,17-20H,8H2,1H3 |
| InChIKey | IVFZHNGWQGVCRI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|