About (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one
(2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one (PubChem CID 70318924) has the molecular formula C15H12O6
and a molecular weight of 288.25 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one.
Molecular Properties
| Compound Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one |
| PubChem CID | 70318924 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one |
| SMILES | O=C1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H12O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,15-19H,6H2/t15-/m0/s1 |
| InChIKey | NTNWIYXAYIKFSF-HNNXBMFYSA-N |
| XLogP | 1.75 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one?
The IUPAC name of (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one (CID 70318924) is (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one.
What is the SMILES notation for (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one?
The canonical SMILES for (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one is O=C1Cc2c(O)cc(O)cc2O[C@H]1c1ccc(O)c(O)c1.
What is the InChIKey of (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one?
The InChIKey is NTNWIYXAYIKFSF-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H12O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,15-19H,6H2/t15-/m0/s1.
What are the key properties of (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one?
(2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one has a molecular weight of 288.25 g/mol, XLogP of 1.75, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-3-one is sourced from PubChem (CID 70318924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).